C27H24N4O5 — CID 39602145
[2-[(1-benzyl-3-cyano-4,5-dimethylpyrrol-2-yl)amino]-2-oxoethyl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 39602145) has the molecular formula C27H24N4O5 and a molecular weight of 484.51 g/mol. Its IUPAC name is [2-[(1-benzyl-3-cyano-4,5-dimethylpyrrol-2-yl)amino]-2-oxoethyl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | [2-[(1-benzyl-3-cyano-4,5-dimethylpyrrol-2-yl)amino]-2-oxoethyl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 39602145 |
| Molecular Formula | C27H24N4O5 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | [2-[(1-benzyl-3-cyano-4,5-dimethylpyrrol-2-yl)amino]-2-oxoethyl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | Cc1c(C#N)c(NC(=O)COC(=O)c2ccc(N3C(=O)CCC3=O)cc2)n(Cc2ccccc2)c1C |
| InChI | InChI=1S/C27H24N4O5/c1-17-18(2)30(15-19-6-4-3-5-7-19)26(22(17)14-28)29-23(32)16-36-27(35)20-8-10-21(11-9-20)31-24(33)12-13-25(31)34/h3-11H,12-13,15-16H2,1-2H3,(H,29,32) |
| InChIKey | ROCISJQTWRXUJT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 121.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|