C21H22ClNO5 — CID 2600506
(2-oxo-2-pyrrolidin-1-ylethyl) 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate (PubChem CID 2600506) has the molecular formula C21H22ClNO5 and a molecular weight of 403.86 g/mol. Its IUPAC name is (2-oxo-2-pyrrolidin-1-ylethyl) 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate.
| Compound Name | (2-oxo-2-pyrrolidin-1-ylethyl) 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate |
|---|---|
| PubChem CID | 2600506 |
| Molecular Formula | C21H22ClNO5 |
| Molecular Weight | 403.86 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | (2-oxo-2-pyrrolidin-1-ylethyl) 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)N2CCCC2)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C21H22ClNO5/c1-26-19-12-15(21(25)28-14-20(24)23-10-4-5-11-23)8-9-18(19)27-13-16-6-2-3-7-17(16)22/h2-3,6-9,12H,4-5,10-11,13-14H2,1H3 |
| InChIKey | AZZLDLAVVFZDGN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.86 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |