C19H18ClNO4 — CID 24530110
3-cyanopropyl 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate (PubChem CID 24530110) has the molecular formula C19H18ClNO4 and a molecular weight of 359.81 g/mol. Its IUPAC name is 3-cyanopropyl 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate.
| Compound Name | 3-cyanopropyl 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate |
|---|---|
| PubChem CID | 24530110 |
| Molecular Formula | C19H18ClNO4 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 3-cyanopropyl 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OCCCC#N)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C19H18ClNO4/c1-23-18-12-14(19(22)24-11-5-4-10-21)8-9-17(18)25-13-15-6-2-3-7-16(15)20/h2-3,6-9,12H,4-5,11,13H2,1H3 |
| InChIKey | UNZLCPWGFMSRRL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|