C17H22N2O6 — CID 8012097
[2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 3,4-dimethoxybenzoate (PubChem CID 8012097) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 3,4-dimethoxybenzoate.
| Compound Name | [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 8012097 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)N2CCC(C(N)=O)CC2)cc1OC |
| InChI | InChI=1S/C17H22N2O6/c1-23-13-4-3-12(9-14(13)24-2)17(22)25-10-15(20)19-7-5-11(6-8-19)16(18)21/h3-4,9,11H,5-8,10H2,1-2H3,(H2,18,21) |
| InChIKey | CSUDNYBVRVSVMY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |