C15H18N4O3 — CID 60509400
N'-(4-methoxypyrimidin-2-yl)-3-propoxybenzohydrazide (PubChem CID 60509400) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is N'-(4-methoxypyrimidin-2-yl)-3-propoxybenzohydrazide.
| Compound Name | N'-(4-methoxypyrimidin-2-yl)-3-propoxybenzohydrazide |
|---|---|
| PubChem CID | 60509400 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N'-(4-methoxypyrimidin-2-yl)-3-propoxybenzohydrazide |
| SMILES | CCCOc1cccc(C(=O)NNc2nccc(OC)n2)c1 |
| InChI | InChI=1S/C15H18N4O3/c1-3-9-22-12-6-4-5-11(10-12)14(20)18-19-15-16-8-7-13(17-15)21-2/h4-8,10H,3,9H2,1-2H3,(H,18,20)(H,16,17,19) |
| InChIKey | ATMCENDBSSOGOE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|