C20H18N2O5 — CID 78822023
N'-[2-(4-hydroxyphenyl)acetyl]-5-(phenoxymethyl)furan-2-carbohydrazide (PubChem CID 78822023) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is N'-[2-(4-hydroxyphenyl)acetyl]-5-(phenoxymethyl)furan-2-carbohydrazide.
| Compound Name | N'-[2-(4-hydroxyphenyl)acetyl]-5-(phenoxymethyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 78822023 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N'-[2-(4-hydroxyphenyl)acetyl]-5-(phenoxymethyl)furan-2-carbohydrazide |
| SMILES | O=C(Cc1ccc(O)cc1)NNC(=O)c1ccc(COc2ccccc2)o1 |
| InChI | InChI=1S/C20H18N2O5/c23-15-8-6-14(7-9-15)12-19(24)21-22-20(25)18-11-10-17(27-18)13-26-16-4-2-1-3-5-16/h1-11,23H,12-13H2,(H,21,24)(H,22,25) |
| InChIKey | VRIFSYRLFFYKCR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|