C24H23N3O4 — CID 2119955
N'-[(3S)-1-naphthalen-2-yl-2,5-dioxopyrrolidin-3-yl]-4-propoxybenzohydrazide (PubChem CID 2119955) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is N'-[(3S)-1-naphthalen-2-yl-2,5-dioxopyrrolidin-3-yl]-4-propoxybenzohydrazide.
| Compound Name | N'-[(3S)-1-naphthalen-2-yl-2,5-dioxopyrrolidin-3-yl]-4-propoxybenzohydrazide |
|---|---|
| PubChem CID | 2119955 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | N'-[(3S)-1-naphthalen-2-yl-2,5-dioxopyrrolidin-3-yl]-4-propoxybenzohydrazide |
| SMILES | CCCOc1ccc(C(=O)NN[C@H]2CC(=O)N(c3ccc4ccccc4c3)C2=O)cc1 |
| InChI | InChI=1S/C24H23N3O4/c1-2-13-31-20-11-8-17(9-12-20)23(29)26-25-21-15-22(28)27(24(21)30)19-10-7-16-5-3-4-6-18(16)14-19/h3-12,14,21,25H,2,13,15H2,1H3,(H,26,29)/t21-/m0/s1 |
| InChIKey | WFTLSTKENCADQV-NRFANRHFSA-N |
| XLogP | 3.20 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|