C18H18BrN3O4S — CID 3709391
5-bromo-N'-[2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl]thiophene-2-carbohydrazide (PubChem CID 3709391) has the molecular formula C18H18BrN3O4S and a molecular weight of 452.33 g/mol. Its IUPAC name is 5-bromo-N'-[2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl]thiophene-2-carbohydrazide.
| Compound Name | 5-bromo-N'-[2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 3709391 |
| Molecular Formula | C18H18BrN3O4S |
| Molecular Weight | 452.33 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | 5-bromo-N'-[2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl]thiophene-2-carbohydrazide |
| SMILES | CCCOc1ccc(N2C(=O)CC(NNC(=O)c3ccc(Br)s3)C2=O)cc1 |
| InChI | InChI=1S/C18H18BrN3O4S/c1-2-9-26-12-5-3-11(4-6-12)22-16(23)10-13(18(22)25)20-21-17(24)14-7-8-15(19)27-14/h3-8,13,20H,2,9-10H2,1H3,(H,21,24) |
| InChIKey | DKYWPLIQTYEWLO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|