C36H27N3O6 — CID 21171413
[2-oxo-2-(4-phenylphenyl)ethyl] 4-[3-[2-(naphthalene-2-carbonyl)hydrazinyl]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 21171413) has the molecular formula C36H27N3O6 and a molecular weight of 597.63 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylphenyl)ethyl] 4-[3-[2-(naphthalene-2-carbonyl)hydrazinyl]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-oxo-2-(4-phenylphenyl)ethyl] 4-[3-[2-(naphthalene-2-carbonyl)hydrazinyl]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21171413 |
| Molecular Formula | C36H27N3O6 |
| Molecular Weight | 597.63 g/mol |
| Exact Mass | 597.19 |
| IUPAC Name | [2-oxo-2-(4-phenylphenyl)ethyl] 4-[3-[2-(naphthalene-2-carbonyl)hydrazinyl]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)CC(NNC(=O)c3ccc4ccccc4c3)C2=O)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C36H27N3O6/c40-32(26-13-10-25(11-14-26)23-6-2-1-3-7-23)22-45-36(44)27-16-18-30(19-17-27)39-33(41)21-31(35(39)43)37-38-34(42)29-15-12-24-8-4-5-9-28(24)20-29/h1-20,31,37H,21-22H2,(H,38,42) |
| InChIKey | QFIZLPGNMMFWCI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.63 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|