C22H27N5O4S — CID 39977948
N'-[(3R)-1-(3-ethylphenyl)-5-oxopyrrolidine-3-carbonyl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide (PubChem CID 39977948) has the molecular formula C22H27N5O4S and a molecular weight of 457.56 g/mol. Its IUPAC name is N'-[(3R)-1-(3-ethylphenyl)-5-oxopyrrolidine-3-carbonyl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-[(3R)-1-(3-ethylphenyl)-5-oxopyrrolidine-3-carbonyl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 39977948 |
| Molecular Formula | C22H27N5O4S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | N'-[(3R)-1-(3-ethylphenyl)-5-oxopyrrolidine-3-carbonyl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
| SMILES | CCc1cccc(N2C[C@H](C(=O)NNC(=O)c3sc(N4CCOCC4)nc3C)CC2=O)c1 |
| InChI | InChI=1S/C22H27N5O4S/c1-3-15-5-4-6-17(11-15)27-13-16(12-18(27)28)20(29)24-25-21(30)19-14(2)23-22(32-19)26-7-9-31-10-8-26/h4-6,11,16H,3,7-10,12-13H2,1-2H3,(H,24,29)(H,25,30)/t16-/m1/s1 |
| InChIKey | PLSZGKZCHYTMTJ-MRXNPFEDSA-N |
| XLogP | 1.66 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|