C19H20ClN5O3S — CID 60566615
N'-[2-(6-chloroindol-1-yl)acetyl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide (PubChem CID 60566615) has the molecular formula C19H20ClN5O3S and a molecular weight of 433.92 g/mol. Its IUPAC name is N'-[2-(6-chloroindol-1-yl)acetyl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-[2-(6-chloroindol-1-yl)acetyl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 60566615 |
| Molecular Formula | C19H20ClN5O3S |
| Molecular Weight | 433.92 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | N'-[2-(6-chloroindol-1-yl)acetyl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(N2CCOCC2)sc1C(=O)NNC(=O)Cn1ccc2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H20ClN5O3S/c1-12-17(29-19(21-12)24-6-8-28-9-7-24)18(27)23-22-16(26)11-25-5-4-13-2-3-14(20)10-15(13)25/h2-5,10H,6-9,11H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | SLWGVCDYTDLYOH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.92 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|