C19H20N6O3S2 — CID 24553606
4-methyl-2-morpholin-4-yl-N'-(3-phenyl-2-sulfanylidene-1H-imidazole-4-carbonyl)-1,3-thiazole-5-carbohydrazide (PubChem CID 24553606) has the molecular formula C19H20N6O3S2 and a molecular weight of 444.54 g/mol. Its IUPAC name is 4-methyl-2-morpholin-4-yl-N'-(3-phenyl-2-sulfanylidene-1H-imidazole-4-carbonyl)-1,3-thiazole-5-carbohydrazide.
| Compound Name | 4-methyl-2-morpholin-4-yl-N'-(3-phenyl-2-sulfanylidene-1H-imidazole-4-carbonyl)-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 24553606 |
| Molecular Formula | C19H20N6O3S2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 4-methyl-2-morpholin-4-yl-N'-(3-phenyl-2-sulfanylidene-1H-imidazole-4-carbonyl)-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(N2CCOCC2)sc1C(=O)NNC(=O)c1c[nH]c(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C19H20N6O3S2/c1-12-15(30-19(21-12)24-7-9-28-10-8-24)17(27)23-22-16(26)14-11-20-18(29)25(14)13-5-3-2-4-6-13/h2-6,11H,7-10H2,1H3,(H,20,29)(H,22,26)(H,23,27) |
| InChIKey | UJQZQGTXUJYJEA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|