C17H15FN4O3 — CID 43840997
N'-[1-(2-fluoro-4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]pyridine-3-carbohydrazide (PubChem CID 43840997) has the molecular formula C17H15FN4O3 and a molecular weight of 342.33 g/mol. Its IUPAC name is N'-[1-(2-fluoro-4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-[1-(2-fluoro-4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 43840997 |
| Molecular Formula | C17H15FN4O3 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | N'-[1-(2-fluoro-4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]pyridine-3-carbohydrazide |
| SMILES | Cc1ccc(N2C(=O)CC(NNC(=O)c3cccnc3)C2=O)c(F)c1 |
| InChI | InChI=1S/C17H15FN4O3/c1-10-4-5-14(12(18)7-10)22-15(23)8-13(17(22)25)20-21-16(24)11-3-2-6-19-9-11/h2-7,9,13,20H,8H2,1H3,(H,21,24) |
| InChIKey | SPJRVDIQTSCTFX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|