C24H19ClN4O4 — CID 5115038
N'-benzoyl-N-[1-(5-chloro-2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]pyridine-3-carbohydrazide (PubChem CID 5115038) has the molecular formula C24H19ClN4O4 and a molecular weight of 462.89 g/mol. Its IUPAC name is N'-benzoyl-N-[1-(5-chloro-2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-benzoyl-N-[1-(5-chloro-2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 5115038 |
| Molecular Formula | C24H19ClN4O4 |
| Molecular Weight | 462.89 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | N'-benzoyl-N-[1-(5-chloro-2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]pyridine-3-carbohydrazide |
| SMILES | Cc1ccc(Cl)cc1N1C(=O)CC(N(NC(=O)c2ccccc2)C(=O)c2cccnc2)C1=O |
| InChI | InChI=1S/C24H19ClN4O4/c1-15-9-10-18(25)12-19(15)28-21(30)13-20(24(28)33)29(23(32)17-8-5-11-26-14-17)27-22(31)16-6-3-2-4-7-16/h2-12,14,20H,13H2,1H3,(H,27,31) |
| InChIKey | WNNGNNHRTYIJHY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.89 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|