C24H18N4O6 — CID 3288338
N'-[1-(1,3-benzodioxol-5-yl)-2,5-dioxopyrrolidin-3-yl]-N'-benzoylpyridine-4-carbohydrazide (PubChem CID 3288338) has the molecular formula C24H18N4O6 and a molecular weight of 458.43 g/mol. Its IUPAC name is N'-[1-(1,3-benzodioxol-5-yl)-2,5-dioxopyrrolidin-3-yl]-N'-benzoylpyridine-4-carbohydrazide.
| Compound Name | N'-[1-(1,3-benzodioxol-5-yl)-2,5-dioxopyrrolidin-3-yl]-N'-benzoylpyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 3288338 |
| Molecular Formula | C24H18N4O6 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | N'-[1-(1,3-benzodioxol-5-yl)-2,5-dioxopyrrolidin-3-yl]-N'-benzoylpyridine-4-carbohydrazide |
| SMILES | O=C(NN(C(=O)c1ccccc1)C1CC(=O)N(c2ccc3c(c2)OCO3)C1=O)c1ccncc1 |
| InChI | InChI=1S/C24H18N4O6/c29-21-13-18(24(32)27(21)17-6-7-19-20(12-17)34-14-33-19)28(23(31)16-4-2-1-3-5-16)26-22(30)15-8-10-25-11-9-15/h1-12,18H,13-14H2,(H,26,30) |
| InChIKey | FAJCAWPJNFQQDU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 118.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|