C25H18FN3O6 — CID 4208372
N'-[1-(1,3-benzodioxol-5-yl)-2,5-dioxopyrrolidin-3-yl]-N'-benzoyl-2-fluorobenzohydrazide (PubChem CID 4208372) has the molecular formula C25H18FN3O6 and a molecular weight of 475.43 g/mol. Its IUPAC name is N'-[1-(1,3-benzodioxol-5-yl)-2,5-dioxopyrrolidin-3-yl]-N'-benzoyl-2-fluorobenzohydrazide.
| Compound Name | N'-[1-(1,3-benzodioxol-5-yl)-2,5-dioxopyrrolidin-3-yl]-N'-benzoyl-2-fluorobenzohydrazide |
|---|---|
| PubChem CID | 4208372 |
| Molecular Formula | C25H18FN3O6 |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | N'-[1-(1,3-benzodioxol-5-yl)-2,5-dioxopyrrolidin-3-yl]-N'-benzoyl-2-fluorobenzohydrazide |
| SMILES | O=C(NN(C(=O)c1ccccc1)C1CC(=O)N(c2ccc3c(c2)OCO3)C1=O)c1ccccc1F |
| InChI | InChI=1S/C25H18FN3O6/c26-18-9-5-4-8-17(18)23(31)27-29(24(32)15-6-2-1-3-7-15)19-13-22(30)28(25(19)33)16-10-11-20-21(12-16)35-14-34-20/h1-12,19H,13-14H2,(H,27,31) |
| InChIKey | SQLFNAHUHALIMW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|