C23H16Cl2N4O4 — CID 4242541
N'-benzoyl-N'-[1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]pyridine-3-carbohydrazide (PubChem CID 4242541) has the molecular formula C23H16Cl2N4O4 and a molecular weight of 483.31 g/mol. Its IUPAC name is N'-benzoyl-N'-[1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-benzoyl-N'-[1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 4242541 |
| Molecular Formula | C23H16Cl2N4O4 |
| Molecular Weight | 483.31 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | N'-benzoyl-N'-[1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]pyridine-3-carbohydrazide |
| SMILES | O=C(NN(C(=O)c1ccccc1)C1CC(=O)N(c2ccc(Cl)c(Cl)c2)C1=O)c1cccnc1 |
| InChI | InChI=1S/C23H16Cl2N4O4/c24-17-9-8-16(11-18(17)25)28-20(30)12-19(23(28)33)29(22(32)14-5-2-1-3-6-14)27-21(31)15-7-4-10-26-13-15/h1-11,13,19H,12H2,(H,27,31) |
| InChIKey | MCRMMQRIQBLGNF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|