C22H24N4O5 — CID 3896554
N'-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-methylpropanoyl)pyridine-3-carbohydrazide (PubChem CID 3896554) has the molecular formula C22H24N4O5 and a molecular weight of 424.46 g/mol. Its IUPAC name is N'-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-methylpropanoyl)pyridine-3-carbohydrazide.
| Compound Name | N'-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-methylpropanoyl)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 3896554 |
| Molecular Formula | C22H24N4O5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | N'-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-methylpropanoyl)pyridine-3-carbohydrazide |
| SMILES | CCOc1ccc(N2C(=O)CC(N(NC(=O)c3cccnc3)C(=O)C(C)C)C2=O)cc1 |
| InChI | InChI=1S/C22H24N4O5/c1-4-31-17-9-7-16(8-10-17)25-19(27)12-18(22(25)30)26(21(29)14(2)3)24-20(28)15-6-5-11-23-13-15/h5-11,13-14,18H,4,12H2,1-3H3,(H,24,28) |
| InChIKey | VKZSKDNGIYFKAS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|