C25H29N3O7 — CID 27892722
3,4-dimethoxy-N'-[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-[(2R)-2-methylbutanoyl]benzohydrazide (PubChem CID 27892722) has the molecular formula C25H29N3O7 and a molecular weight of 483.52 g/mol. Its IUPAC name is 3,4-dimethoxy-N'-[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-[(2R)-2-methylbutanoyl]benzohydrazide.
| Compound Name | 3,4-dimethoxy-N'-[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-[(2R)-2-methylbutanoyl]benzohydrazide |
|---|---|
| PubChem CID | 27892722 |
| Molecular Formula | C25H29N3O7 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 3,4-dimethoxy-N'-[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-[(2R)-2-methylbutanoyl]benzohydrazide |
| SMILES | CC[C@@H](C)C(=O)N(NC(=O)c1ccc(OC)c(OC)c1)[C@H]1CC(=O)N(c2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C25H29N3O7/c1-6-15(2)24(31)28(26-23(30)16-7-12-20(34-4)21(13-16)35-5)19-14-22(29)27(25(19)32)17-8-10-18(33-3)11-9-17/h7-13,15,19H,6,14H2,1-5H3,(H,26,30)/t15-,19+/m1/s1 |
| InChIKey | WPDUVKOGFJGWHE-BEFAXECRSA-N |
| XLogP | 2.56 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|