C22H21ClFN3O6 — CID 3983369
N'-[1-(3-chloro-4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-3,4-dimethoxy-N'-propanoylbenzohydrazide (PubChem CID 3983369) has the molecular formula C22H21ClFN3O6 and a molecular weight of 477.88 g/mol. Its IUPAC name is N'-[1-(3-chloro-4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-3,4-dimethoxy-N'-propanoylbenzohydrazide.
| Compound Name | N'-[1-(3-chloro-4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-3,4-dimethoxy-N'-propanoylbenzohydrazide |
|---|---|
| PubChem CID | 3983369 |
| Molecular Formula | C22H21ClFN3O6 |
| Molecular Weight | 477.88 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | N'-[1-(3-chloro-4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-3,4-dimethoxy-N'-propanoylbenzohydrazide |
| SMILES | CCC(=O)N(NC(=O)c1ccc(OC)c(OC)c1)C1CC(=O)N(c2ccc(F)c(Cl)c2)C1=O |
| InChI | InChI=1S/C22H21ClFN3O6/c1-4-19(28)27(25-21(30)12-5-8-17(32-2)18(9-12)33-3)16-11-20(29)26(22(16)31)13-6-7-15(24)14(23)10-13/h5-10,16H,4,11H2,1-3H3,(H,25,30) |
| InChIKey | VFJWQZHSPFDAMS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.88 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|