C25H21ClN4O5 — CID 3983480
N'-(4-chlorobenzoyl)-N'-[1-(2-methoxy-5-methylphenyl)-2,5-dioxopyrrolidin-3-yl]pyridine-4-carbohydrazide (PubChem CID 3983480) has the molecular formula C25H21ClN4O5 and a molecular weight of 492.92 g/mol. Its IUPAC name is N'-(4-chlorobenzoyl)-N'-[1-(2-methoxy-5-methylphenyl)-2,5-dioxopyrrolidin-3-yl]pyridine-4-carbohydrazide.
| Compound Name | N'-(4-chlorobenzoyl)-N'-[1-(2-methoxy-5-methylphenyl)-2,5-dioxopyrrolidin-3-yl]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 3983480 |
| Molecular Formula | C25H21ClN4O5 |
| Molecular Weight | 492.92 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | N'-(4-chlorobenzoyl)-N'-[1-(2-methoxy-5-methylphenyl)-2,5-dioxopyrrolidin-3-yl]pyridine-4-carbohydrazide |
| SMILES | COc1ccc(C)cc1N1C(=O)CC(N(NC(=O)c2ccncc2)C(=O)c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C25H21ClN4O5/c1-15-3-8-21(35-2)19(13-15)29-22(31)14-20(25(29)34)30(24(33)17-4-6-18(26)7-5-17)28-23(32)16-9-11-27-12-10-16/h3-13,20H,14H2,1-2H3,(H,28,32) |
| InChIKey | XUHYUABEVOCRQO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.92 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|