C22H22N4O7 — CID 3322181
N'-[1-(2-methoxy-5-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-2-nitro-N'-propanoylbenzohydrazide (PubChem CID 3322181) has the molecular formula C22H22N4O7 and a molecular weight of 454.44 g/mol. Its IUPAC name is N'-[1-(2-methoxy-5-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-2-nitro-N'-propanoylbenzohydrazide.
| Compound Name | N'-[1-(2-methoxy-5-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-2-nitro-N'-propanoylbenzohydrazide |
|---|---|
| PubChem CID | 3322181 |
| Molecular Formula | C22H22N4O7 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | N'-[1-(2-methoxy-5-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-2-nitro-N'-propanoylbenzohydrazide |
| SMILES | CCC(=O)N(NC(=O)c1ccccc1[N+](=O)[O-])C1CC(=O)N(c2cc(C)ccc2OC)C1=O |
| InChI | InChI=1S/C22H22N4O7/c1-4-19(27)25(23-21(29)14-7-5-6-8-15(14)26(31)32)17-12-20(28)24(22(17)30)16-11-13(2)9-10-18(16)33-3/h5-11,17H,4,12H2,1-3H3,(H,23,29) |
| InChIKey | OIOJMXHYJILOQG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|