C28H27N3O5 — CID 3749099
N'-acetyl-N'-[1-(2-methoxy-5-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-2,2-diphenylacetohydrazide (PubChem CID 3749099) has the molecular formula C28H27N3O5 and a molecular weight of 485.54 g/mol. Its IUPAC name is N'-acetyl-N'-[1-(2-methoxy-5-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-2,2-diphenylacetohydrazide.
| Compound Name | N'-acetyl-N'-[1-(2-methoxy-5-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 3749099 |
| Molecular Formula | C28H27N3O5 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N'-acetyl-N'-[1-(2-methoxy-5-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-2,2-diphenylacetohydrazide |
| SMILES | COc1ccc(C)cc1N1C(=O)CC(N(NC(=O)C(c2ccccc2)c2ccccc2)C(C)=O)C1=O |
| InChI | InChI=1S/C28H27N3O5/c1-18-14-15-24(36-3)22(16-18)30-25(33)17-23(28(30)35)31(19(2)32)29-27(34)26(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-16,23,26H,17H2,1-3H3,(H,29,34) |
| InChIKey | SQXBBYWZMIOYOI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|