C23H25N3O7 — CID 3584190
N-[1-(2,4-dimethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-phenoxyacetyl)propanehydrazide (PubChem CID 3584190) has the molecular formula C23H25N3O7 and a molecular weight of 455.47 g/mol. Its IUPAC name is N-[1-(2,4-dimethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-phenoxyacetyl)propanehydrazide.
| Compound Name | N-[1-(2,4-dimethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-phenoxyacetyl)propanehydrazide |
|---|---|
| PubChem CID | 3584190 |
| Molecular Formula | C23H25N3O7 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | N-[1-(2,4-dimethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-phenoxyacetyl)propanehydrazide |
| SMILES | CCC(=O)N(NC(=O)COc1ccccc1)C1CC(=O)N(c2ccc(OC)cc2OC)C1=O |
| InChI | InChI=1S/C23H25N3O7/c1-4-21(28)26(24-20(27)14-33-15-8-6-5-7-9-15)18-13-22(29)25(23(18)30)17-11-10-16(31-2)12-19(17)32-3/h5-12,18H,4,13-14H2,1-3H3,(H,24,27) |
| InChIKey | BTUNJGXZLHHTAG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|