C27H25N3O6 — CID 3916327
N'-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-phenoxyacetyl)-2-phenylacetohydrazide (PubChem CID 3916327) has the molecular formula C27H25N3O6 and a molecular weight of 487.51 g/mol. Its IUPAC name is N'-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-phenoxyacetyl)-2-phenylacetohydrazide.
| Compound Name | N'-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-phenoxyacetyl)-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 3916327 |
| Molecular Formula | C27H25N3O6 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | N'-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-phenoxyacetyl)-2-phenylacetohydrazide |
| SMILES | COc1ccc(N2C(=O)CC(N(NC(=O)Cc3ccccc3)C(=O)COc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C27H25N3O6/c1-35-21-14-12-20(13-15-21)29-25(32)17-23(27(29)34)30(26(33)18-36-22-10-6-3-7-11-22)28-24(31)16-19-8-4-2-5-9-19/h2-15,23H,16-18H2,1H3,(H,28,31) |
| InChIKey | KLSXXVZUIBRHGL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|