C25H23N3O6 — CID 3830816
N'-acetyl-N'-[1-(3-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-2-naphthalen-2-yloxyacetohydrazide (PubChem CID 3830816) has the molecular formula C25H23N3O6 and a molecular weight of 461.47 g/mol. Its IUPAC name is N'-acetyl-N'-[1-(3-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-2-naphthalen-2-yloxyacetohydrazide.
| Compound Name | N'-acetyl-N'-[1-(3-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-2-naphthalen-2-yloxyacetohydrazide |
|---|---|
| PubChem CID | 3830816 |
| Molecular Formula | C25H23N3O6 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | N'-acetyl-N'-[1-(3-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-2-naphthalen-2-yloxyacetohydrazide |
| SMILES | COc1cccc(N2C(=O)CC(N(NC(=O)COc3ccc4ccccc4c3)C(C)=O)C2=O)c1 |
| InChI | InChI=1S/C25H23N3O6/c1-16(29)28(22-14-24(31)27(25(22)32)19-8-5-9-20(13-19)33-2)26-23(30)15-34-21-11-10-17-6-3-4-7-18(17)12-21/h3-13,22H,14-15H2,1-2H3,(H,26,30) |
| InChIKey | OHWDTUDKWMLVLN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|