C26H23N3O7 — CID 3645428
N'-acetyl-N'-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,5-dioxopyrrolidin-3-yl]-2-naphthalen-1-yloxyacetohydrazide (PubChem CID 3645428) has the molecular formula C26H23N3O7 and a molecular weight of 489.48 g/mol. Its IUPAC name is N'-acetyl-N'-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,5-dioxopyrrolidin-3-yl]-2-naphthalen-1-yloxyacetohydrazide.
| Compound Name | N'-acetyl-N'-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,5-dioxopyrrolidin-3-yl]-2-naphthalen-1-yloxyacetohydrazide |
|---|---|
| PubChem CID | 3645428 |
| Molecular Formula | C26H23N3O7 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | N'-acetyl-N'-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,5-dioxopyrrolidin-3-yl]-2-naphthalen-1-yloxyacetohydrazide |
| SMILES | CC(=O)N(NC(=O)COc1cccc2ccccc12)C1CC(=O)N(c2ccc3c(c2)OCCO3)C1=O |
| InChI | InChI=1S/C26H23N3O7/c1-16(30)29(27-24(31)15-36-21-8-4-6-17-5-2-3-7-19(17)21)20-14-25(32)28(26(20)33)18-9-10-22-23(13-18)35-12-11-34-22/h2-10,13,20H,11-12,14-15H2,1H3,(H,27,31) |
| InChIKey | RGBIIIWGQKYLHE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|