C25H23N3O5 — CID 5135838
N'-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-propanoylnaphthalene-1-carbohydrazide (PubChem CID 5135838) has the molecular formula C25H23N3O5 and a molecular weight of 445.48 g/mol. Its IUPAC name is N'-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-propanoylnaphthalene-1-carbohydrazide.
| Compound Name | N'-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-propanoylnaphthalene-1-carbohydrazide |
|---|---|
| PubChem CID | 5135838 |
| Molecular Formula | C25H23N3O5 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | N'-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-propanoylnaphthalene-1-carbohydrazide |
| SMILES | CCC(=O)N(NC(=O)c1cccc2ccccc12)C1CC(=O)N(c2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C25H23N3O5/c1-3-22(29)28(26-24(31)20-10-6-8-16-7-4-5-9-19(16)20)21-15-23(30)27(25(21)32)17-11-13-18(33-2)14-12-17/h4-14,21H,3,15H2,1-2H3,(H,26,31) |
| InChIKey | KTPBGSISGXNXPI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|