C27H24ClN3O5 — CID 3406675
N'-(4-chlorobenzoyl)-N-[1-(4-ethylphenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxybenzohydrazide (PubChem CID 3406675) has the molecular formula C27H24ClN3O5 and a molecular weight of 505.96 g/mol. Its IUPAC name is N'-(4-chlorobenzoyl)-N-[1-(4-ethylphenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxybenzohydrazide.
| Compound Name | N'-(4-chlorobenzoyl)-N-[1-(4-ethylphenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxybenzohydrazide |
|---|---|
| PubChem CID | 3406675 |
| Molecular Formula | C27H24ClN3O5 |
| Molecular Weight | 505.96 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | N'-(4-chlorobenzoyl)-N-[1-(4-ethylphenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxybenzohydrazide |
| SMILES | CCc1ccc(N2C(=O)CC(N(NC(=O)c3ccc(Cl)cc3)C(=O)c3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H24ClN3O5/c1-3-17-4-12-21(13-5-17)30-24(32)16-23(27(30)35)31(26(34)19-8-14-22(36-2)15-9-19)29-25(33)18-6-10-20(28)11-7-18/h4-15,23H,3,16H2,1-2H3,(H,29,33) |
| InChIKey | CCCUDDKZQBBYSZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.96 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|