C25H20ClFN2O4 — CID 5145093
4-chloro-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[(4-methoxyphenyl)methyl]benzamide (PubChem CID 5145093) has the molecular formula C25H20ClFN2O4 and a molecular weight of 466.90 g/mol. Its IUPAC name is 4-chloro-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[(4-methoxyphenyl)methyl]benzamide.
| Compound Name | 4-chloro-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[(4-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 5145093 |
| Molecular Formula | C25H20ClFN2O4 |
| Molecular Weight | 466.90 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 4-chloro-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[(4-methoxyphenyl)methyl]benzamide |
| SMILES | COc1ccc(CN(C(=O)c2ccc(Cl)cc2)C2CC(=O)N(c3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H20ClFN2O4/c1-33-21-12-2-16(3-13-21)15-28(24(31)17-4-6-18(26)7-5-17)22-14-23(30)29(25(22)32)20-10-8-19(27)9-11-20/h2-13,22H,14-15H2,1H3 |
| InChIKey | KYEDUPXJHYBACL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.90 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|