C28H25N3O4 — CID 4040999
N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-N'-(2,2-diphenylacetyl)but-2-enehydrazide (PubChem CID 4040999) has the molecular formula C28H25N3O4 and a molecular weight of 467.53 g/mol. Its IUPAC name is N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-N'-(2,2-diphenylacetyl)but-2-enehydrazide.
| Compound Name | N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-N'-(2,2-diphenylacetyl)but-2-enehydrazide |
|---|---|
| PubChem CID | 4040999 |
| Molecular Formula | C28H25N3O4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-N'-(2,2-diphenylacetyl)but-2-enehydrazide |
| SMILES | CC=CC(=O)N(NC(=O)C(c1ccccc1)c1ccccc1)C1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C28H25N3O4/c1-2-12-24(32)31(23-19-25(33)30(28(23)35)22-17-10-5-11-18-22)29-27(34)26(20-13-6-3-7-14-20)21-15-8-4-9-16-21/h2-18,23,26H,19H2,1H3,(H,29,34) |
| InChIKey | RTQNFALFXRPXEQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|