C24H24FN3O7 — CID 3396312
N'-but-2-enoyl-N'-[1-(3-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-3,4,5-trimethoxybenzohydrazide (PubChem CID 3396312) has the molecular formula C24H24FN3O7 and a molecular weight of 485.47 g/mol. Its IUPAC name is N'-but-2-enoyl-N'-[1-(3-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-3,4,5-trimethoxybenzohydrazide.
| Compound Name | N'-but-2-enoyl-N'-[1-(3-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-3,4,5-trimethoxybenzohydrazide |
|---|---|
| PubChem CID | 3396312 |
| Molecular Formula | C24H24FN3O7 |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | N'-but-2-enoyl-N'-[1-(3-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-3,4,5-trimethoxybenzohydrazide |
| SMILES | CC=CC(=O)N(NC(=O)c1cc(OC)c(OC)c(OC)c1)C1CC(=O)N(c2cccc(F)c2)C1=O |
| InChI | InChI=1S/C24H24FN3O7/c1-5-7-20(29)28(17-13-21(30)27(24(17)32)16-9-6-8-15(25)12-16)26-23(31)14-10-18(33-2)22(35-4)19(11-14)34-3/h5-12,17H,13H2,1-4H3,(H,26,31) |
| InChIKey | KEVLCHCHNQCUHY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|