C23H20F3N3O5 — CID 4281790
N'-but-2-enoyl-N'-[2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]-4-methoxybenzohydrazide (PubChem CID 4281790) has the molecular formula C23H20F3N3O5 and a molecular weight of 475.42 g/mol. Its IUPAC name is N'-but-2-enoyl-N'-[2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]-4-methoxybenzohydrazide.
| Compound Name | N'-but-2-enoyl-N'-[2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]-4-methoxybenzohydrazide |
|---|---|
| PubChem CID | 4281790 |
| Molecular Formula | C23H20F3N3O5 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | N'-but-2-enoyl-N'-[2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]-4-methoxybenzohydrazide |
| SMILES | CC=CC(=O)N(NC(=O)c1ccc(OC)cc1)C1CC(=O)N(c2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C23H20F3N3O5/c1-3-5-19(30)29(27-21(32)14-8-10-17(34-2)11-9-14)18-13-20(31)28(22(18)33)16-7-4-6-15(12-16)23(24,25)26/h3-12,18H,13H2,1-2H3,(H,27,32) |
| InChIKey | AKUKWJQSXMZCAQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|