C23H22BrN3O4 — CID 5157641
2-bromo-N'-but-2-enoyl-N'-[1-(4-ethylphenyl)-2,5-dioxopyrrolidin-3-yl]benzohydrazide (PubChem CID 5157641) has the molecular formula C23H22BrN3O4 and a molecular weight of 484.35 g/mol. Its IUPAC name is 2-bromo-N'-but-2-enoyl-N'-[1-(4-ethylphenyl)-2,5-dioxopyrrolidin-3-yl]benzohydrazide.
| Compound Name | 2-bromo-N'-but-2-enoyl-N'-[1-(4-ethylphenyl)-2,5-dioxopyrrolidin-3-yl]benzohydrazide |
|---|---|
| PubChem CID | 5157641 |
| Molecular Formula | C23H22BrN3O4 |
| Molecular Weight | 484.35 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | 2-bromo-N'-but-2-enoyl-N'-[1-(4-ethylphenyl)-2,5-dioxopyrrolidin-3-yl]benzohydrazide |
| SMILES | CC=CC(=O)N(NC(=O)c1ccccc1Br)C1CC(=O)N(c2ccc(CC)cc2)C1=O |
| InChI | InChI=1S/C23H22BrN3O4/c1-3-7-20(28)27(25-22(30)17-8-5-6-9-18(17)24)19-14-21(29)26(23(19)31)16-12-10-15(4-2)11-13-16/h3,5-13,19H,4,14H2,1-2H3,(H,25,30) |
| InChIKey | VICAERVQAADMTQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|