C25H29N3O4 — CID 3658217
2-ethyl-N'-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-phenylacetyl)butanehydrazide (PubChem CID 3658217) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is 2-ethyl-N'-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-phenylacetyl)butanehydrazide.
| Compound Name | 2-ethyl-N'-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-phenylacetyl)butanehydrazide |
|---|---|
| PubChem CID | 3658217 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 2-ethyl-N'-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-phenylacetyl)butanehydrazide |
| SMILES | CCC(CC)C(=O)NN(C(=O)Cc1ccccc1)C1CC(=O)N(c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C25H29N3O4/c1-4-19(5-2)24(31)26-28(23(30)15-18-9-7-6-8-10-18)21-16-22(29)27(25(21)32)20-13-11-17(3)12-14-20/h6-14,19,21H,4-5,15-16H2,1-3H3,(H,26,31) |
| InChIKey | MDARQEGVWHWHEP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|