C24H19ClN4O5 — CID 5115041
N'-[1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-phenoxyacetyl)pyridine-4-carbohydrazide (PubChem CID 5115041) has the molecular formula C24H19ClN4O5 and a molecular weight of 478.89 g/mol. Its IUPAC name is N'-[1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-phenoxyacetyl)pyridine-4-carbohydrazide.
| Compound Name | N'-[1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-phenoxyacetyl)pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 5115041 |
| Molecular Formula | C24H19ClN4O5 |
| Molecular Weight | 478.89 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | N'-[1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-phenoxyacetyl)pyridine-4-carbohydrazide |
| SMILES | O=C(NN(C(=O)COc1ccccc1)C1CC(=O)N(c2cccc(Cl)c2)C1=O)c1ccncc1 |
| InChI | InChI=1S/C24H19ClN4O5/c25-17-5-4-6-18(13-17)28-21(30)14-20(24(28)33)29(27-23(32)16-9-11-26-12-10-16)22(31)15-34-19-7-2-1-3-8-19/h1-13,20H,14-15H2,(H,27,32) |
| InChIKey | NEDJHMJCVXLPPR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.89 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|