C17H16N2O5 — CID 126786075
5-[[1-(4-methylphenyl)-2-oxopyrrolidin-3-yl]carbamoyl]furan-3-carboxylic acid (PubChem CID 126786075) has the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. Its IUPAC name is 5-[[1-(4-methylphenyl)-2-oxopyrrolidin-3-yl]carbamoyl]furan-3-carboxylic acid.
| Compound Name | 5-[[1-(4-methylphenyl)-2-oxopyrrolidin-3-yl]carbamoyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 126786075 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 5-[[1-(4-methylphenyl)-2-oxopyrrolidin-3-yl]carbamoyl]furan-3-carboxylic acid |
| SMILES | Cc1ccc(N2CCC(NC(=O)c3cc(C(=O)O)co3)C2=O)cc1 |
| InChI | InChI=1S/C17H16N2O5/c1-10-2-4-12(5-3-10)19-7-6-13(16(19)21)18-15(20)14-8-11(9-24-14)17(22)23/h2-5,8-9,13H,6-7H2,1H3,(H,18,20)(H,22,23) |
| InChIKey | GOOOXYYXSQLFDJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |