C21H24N2O2 — CID 71839041
N-[1-(3,4-dimethylphenyl)-2-oxopyrrolidin-3-yl]-2,4-dimethylbenzamide (PubChem CID 71839041) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[1-(3,4-dimethylphenyl)-2-oxopyrrolidin-3-yl]-2,4-dimethylbenzamide.
| Compound Name | N-[1-(3,4-dimethylphenyl)-2-oxopyrrolidin-3-yl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 71839041 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N-[1-(3,4-dimethylphenyl)-2-oxopyrrolidin-3-yl]-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2CCN(c3ccc(C)c(C)c3)C2=O)c(C)c1 |
| InChI | InChI=1S/C21H24N2O2/c1-13-5-8-18(16(4)11-13)20(24)22-19-9-10-23(21(19)25)17-7-6-14(2)15(3)12-17/h5-8,11-12,19H,9-10H2,1-4H3,(H,22,24) |
| InChIKey | MNEMTEXQFOFCDV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |