C12H11BrN2O4 — CID 107729779
5-bromo-2-hydroxy-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)benzamide (PubChem CID 107729779) has the molecular formula C12H11BrN2O4 and a molecular weight of 327.13 g/mol. Its IUPAC name is 5-bromo-2-hydroxy-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)benzamide.
| Compound Name | 5-bromo-2-hydroxy-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)benzamide |
|---|---|
| PubChem CID | 107729779 |
| Molecular Formula | C12H11BrN2O4 |
| Molecular Weight | 327.13 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 5-bromo-2-hydroxy-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)benzamide |
| SMILES | CN1C(=O)CC(NC(=O)c2cc(Br)ccc2O)C1=O |
| InChI | InChI=1S/C12H11BrN2O4/c1-15-10(17)5-8(12(15)19)14-11(18)7-4-6(13)2-3-9(7)16/h2-4,8,16H,5H2,1H3,(H,14,18) |
| InChIKey | IYJTVNZYHOSWGC-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.13 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|