C13H14N2O5 — CID 114344484
2,3-dihydroxy-N-(1-methyl-2,6-dioxopiperidin-3-yl)benzamide (PubChem CID 114344484) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is 2,3-dihydroxy-N-(1-methyl-2,6-dioxopiperidin-3-yl)benzamide.
| Compound Name | 2,3-dihydroxy-N-(1-methyl-2,6-dioxopiperidin-3-yl)benzamide |
|---|---|
| PubChem CID | 114344484 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2,3-dihydroxy-N-(1-methyl-2,6-dioxopiperidin-3-yl)benzamide |
| SMILES | CN1C(=O)CCC(NC(=O)c2cccc(O)c2O)C1=O |
| InChI | InChI=1S/C13H14N2O5/c1-15-10(17)6-5-8(13(15)20)14-12(19)7-3-2-4-9(16)11(7)18/h2-4,8,16,18H,5-6H2,1H3,(H,14,19) |
| InChIKey | JHCCYDBOXIMEJW-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|