C16H13ClFNO3 — CID 142729740
N-[(1R)-6-chloro-4-fluoro-2,3-dihydro-1H-inden-1-yl]-2,3-dihydroxybenzamide (PubChem CID 142729740) has the molecular formula C16H13ClFNO3 and a molecular weight of 321.74 g/mol. Its IUPAC name is N-[(1R)-6-chloro-4-fluoro-2,3-dihydro-1H-inden-1-yl]-2,3-dihydroxybenzamide.
| Compound Name | N-[(1R)-6-chloro-4-fluoro-2,3-dihydro-1H-inden-1-yl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 142729740 |
| Molecular Formula | C16H13ClFNO3 |
| Molecular Weight | 321.74 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | N-[(1R)-6-chloro-4-fluoro-2,3-dihydro-1H-inden-1-yl]-2,3-dihydroxybenzamide |
| SMILES | O=C(N[C@@H]1CCc2c(F)cc(Cl)cc21)c1cccc(O)c1O |
| InChI | InChI=1S/C16H13ClFNO3/c17-8-6-11-9(12(18)7-8)4-5-13(11)19-16(22)10-2-1-3-14(20)15(10)21/h1-3,6-7,13,20-21H,4-5H2,(H,19,22)/t13-/m1/s1 |
| InChIKey | ALSFRGKYBAKRRQ-CYBMUJFWSA-N |
| XLogP | 3.31 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.74 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|