C11H19N3O3 — CID 116656521
1-tert-butyl-3-(1-methyl-2,6-dioxopiperidin-3-yl)urea (PubChem CID 116656521) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-tert-butyl-3-(1-methyl-2,6-dioxopiperidin-3-yl)urea.
| Compound Name | 1-tert-butyl-3-(1-methyl-2,6-dioxopiperidin-3-yl)urea |
|---|---|
| PubChem CID | 116656521 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 1-tert-butyl-3-(1-methyl-2,6-dioxopiperidin-3-yl)urea |
| SMILES | CN1C(=O)CCC(NC(=O)NC(C)(C)C)C1=O |
| InChI | InChI=1S/C11H19N3O3/c1-11(2,3)13-10(17)12-7-5-6-8(15)14(4)9(7)16/h7H,5-6H2,1-4H3,(H2,12,13,17) |
| InChIKey | HLZJZWOPBWXNLV-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|