C8H10F2N2O3 — CID 103515786
2,2-difluoro-N-(1-methyl-2,6-dioxopiperidin-3-yl)acetamide (PubChem CID 103515786) has the molecular formula C8H10F2N2O3 and a molecular weight of 220.17 g/mol. Its IUPAC name is 2,2-difluoro-N-(1-methyl-2,6-dioxopiperidin-3-yl)acetamide.
| Compound Name | 2,2-difluoro-N-(1-methyl-2,6-dioxopiperidin-3-yl)acetamide |
|---|---|
| PubChem CID | 103515786 |
| Molecular Formula | C8H10F2N2O3 |
| Molecular Weight | 220.17 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2,2-difluoro-N-(1-methyl-2,6-dioxopiperidin-3-yl)acetamide |
| SMILES | CN1C(=O)CCC(NC(=O)C(F)F)C1=O |
| InChI | InChI=1S/C8H10F2N2O3/c1-12-5(13)3-2-4(8(12)15)11-7(14)6(9)10/h4,6H,2-3H2,1H3,(H,11,14) |
| InChIKey | YYXDMILOBOXBSP-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.17 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|