C16H17FN2O3 — CID 146150011
trans-(1R,2R)-2-(4-fluorophenyl)-N-(1-methyl-2,6-dioxopiperidin-3-yl)cyclopropane-1-carboxamide (PubChem CID 146150011) has the molecular formula C16H17FN2O3 and a molecular weight of 304.32 g/mol. Its IUPAC name is trans-(1R,2R)-2-(4-fluorophenyl)-N-(1-methyl-2,6-dioxopiperidin-3-yl)cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-2-(4-fluorophenyl)-N-(1-methyl-2,6-dioxopiperidin-3-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 146150011 |
| Molecular Formula | C16H17FN2O3 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | trans-(1R,2R)-2-(4-fluorophenyl)-N-(1-methyl-2,6-dioxopiperidin-3-yl)cyclopropane-1-carboxamide |
| SMILES | CN1C(=O)CCC(NC(=O)[C@@H]2C[C@H]2c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C16H17FN2O3/c1-19-14(20)7-6-13(16(19)22)18-15(21)12-8-11(12)9-2-4-10(17)5-3-9/h2-5,11-13H,6-8H2,1H3,(H,18,21)/t11-,12+,13?/m0/s1 |
| InChIKey | WIZLFVVCKHUMHR-LAGVYOHYSA-N |
| XLogP | 1.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|