C14H23N3O3 — CID 114429205
4-ethyl-N-(1-methyl-2,6-dioxopiperidin-3-yl)piperidine-2-carboxamide (PubChem CID 114429205) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-ethyl-N-(1-methyl-2,6-dioxopiperidin-3-yl)piperidine-2-carboxamide.
| Compound Name | 4-ethyl-N-(1-methyl-2,6-dioxopiperidin-3-yl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 114429205 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 4-ethyl-N-(1-methyl-2,6-dioxopiperidin-3-yl)piperidine-2-carboxamide |
| SMILES | CCC1CCNC(C(=O)NC2CCC(=O)N(C)C2=O)C1 |
| InChI | InChI=1S/C14H23N3O3/c1-3-9-6-7-15-11(8-9)13(19)16-10-4-5-12(18)17(2)14(10)20/h9-11,15H,3-8H2,1-2H3,(H,16,19) |
| InChIKey | YDDMFRVWXSANHQ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|