C11H17N3O3S — CID 82915610
N-(1-methyl-2,6-dioxopiperidin-3-yl)thiomorpholine-3-carboxamide (PubChem CID 82915610) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is N-(1-methyl-2,6-dioxopiperidin-3-yl)thiomorpholine-3-carboxamide.
| Compound Name | N-(1-methyl-2,6-dioxopiperidin-3-yl)thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 82915610 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-(1-methyl-2,6-dioxopiperidin-3-yl)thiomorpholine-3-carboxamide |
| SMILES | CN1C(=O)CCC(NC(=O)C2CSCCN2)C1=O |
| InChI | InChI=1S/C11H17N3O3S/c1-14-9(15)3-2-7(11(14)17)13-10(16)8-6-18-5-4-12-8/h7-8,12H,2-6H2,1H3,(H,13,16) |
| InChIKey | TZMOGKMOAXDFRY-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|