C14H18N2OS2 — CID 82906018
N-(3,4-dihydro-2H-thiochromen-4-yl)thiomorpholine-3-carboxamide (PubChem CID 82906018) has the molecular formula C14H18N2OS2 and a molecular weight of 294.44 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-thiochromen-4-yl)thiomorpholine-3-carboxamide.
| Compound Name | N-(3,4-dihydro-2H-thiochromen-4-yl)thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 82906018 |
| Molecular Formula | C14H18N2OS2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | N-(3,4-dihydro-2H-thiochromen-4-yl)thiomorpholine-3-carboxamide |
| SMILES | O=C(NC1CCSc2ccccc21)C1CSCCN1 |
| InChI | InChI=1S/C14H18N2OS2/c17-14(12-9-18-8-6-15-12)16-11-5-7-19-13-4-2-1-3-10(11)13/h1-4,11-12,15H,5-9H2,(H,16,17) |
| InChIKey | UDHOBWZISOGBHT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |