C15H20N2OS — CID 81123604
(3R)-N-(3,4-dihydro-2H-thiochromen-4-yl)piperidine-3-carboxamide (PubChem CID 81123604) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is (3R)-N-(3,4-dihydro-2H-thiochromen-4-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-(3,4-dihydro-2H-thiochromen-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 81123604 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | (3R)-N-(3,4-dihydro-2H-thiochromen-4-yl)piperidine-3-carboxamide |
| SMILES | O=C(NC1CCSc2ccccc21)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C15H20N2OS/c18-15(11-4-3-8-16-10-11)17-13-7-9-19-14-6-2-1-5-12(13)14/h1-2,5-6,11,13,16H,3-4,7-10H2,(H,17,18)/t11-,13?/m1/s1 |
| InChIKey | HZGBIEKMOOXXPQ-JTDNENJMSA-N |
| XLogP | 2.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |