C15H19BrN2O — CID 119317747
N-(4-bromo-2,3-dihydro-1H-inden-1-yl)piperidine-3-carboxamide (PubChem CID 119317747) has the molecular formula C15H19BrN2O and a molecular weight of 323.23 g/mol. Its IUPAC name is N-(4-bromo-2,3-dihydro-1H-inden-1-yl)piperidine-3-carboxamide.
| Compound Name | N-(4-bromo-2,3-dihydro-1H-inden-1-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119317747 |
| Molecular Formula | C15H19BrN2O |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | N-(4-bromo-2,3-dihydro-1H-inden-1-yl)piperidine-3-carboxamide |
| SMILES | O=C(NC1CCc2c(Br)cccc21)C1CCCNC1 |
| InChI | InChI=1S/C15H19BrN2O/c16-13-5-1-4-12-11(13)6-7-14(12)18-15(19)10-3-2-8-17-9-10/h1,4-5,10,14,17H,2-3,6-9H2,(H,18,19) |
| InChIKey | SYVVXDULNQEIKZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |