C11H20N2O3 — CID 114493300
3-[(2-hydroxy-2-methylbutyl)amino]-1-methylpiperidine-2,6-dione (PubChem CID 114493300) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-[(2-hydroxy-2-methylbutyl)amino]-1-methylpiperidine-2,6-dione.
| Compound Name | 3-[(2-hydroxy-2-methylbutyl)amino]-1-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 114493300 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 3-[(2-hydroxy-2-methylbutyl)amino]-1-methylpiperidine-2,6-dione |
| SMILES | CCC(C)(O)CNC1CCC(=O)N(C)C1=O |
| InChI | InChI=1S/C11H20N2O3/c1-4-11(2,16)7-12-8-5-6-9(14)13(3)10(8)15/h8,12,16H,4-7H2,1-3H3 |
| InChIKey | SKQOQBDWOFRSLE-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|